About N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide
N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide (PubChem CID 122191418) has the molecular formula C18H30N4O4
and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide.
Molecular Properties
| Compound Name | N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide |
| PubChem CID | 122191418 |
| Molecular Formula | C18H30N4O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide |
| SMILES | COc1nc(N2CCC(OC)CC2)nc(OC)c1NC(=O)CCC(C)C |
| InChI | InChI=1S/C18H30N4O4/c1-12(2)6-7-14(23)19-15-16(25-4)20-18(21-17(15)26-5)22-10-8-13(24-3)9-11-22/h12-13H,6-11H2,1-5H3,(H,19,23) |
| InChIKey | RBOXJZJAJOZKAZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide?
The IUPAC name of N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide (CID 122191418) is N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide.
What is the SMILES notation for N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide?
The canonical SMILES for N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide is COc1nc(N2CCC(OC)CC2)nc(OC)c1NC(=O)CCC(C)C.
What is the InChIKey of N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide?
The InChIKey is RBOXJZJAJOZKAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4O4/c1-12(2)6-7-14(23)19-15-16(25-4)20-18(21-17(15)26-5)22-10-8-13(24-3)9-11-22/h12-13H,6-11H2,1-5H3,(H,19,23).
What are the key properties of N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide?
N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide has a molecular weight of 366.46 g/mol, XLogP of 2.48, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4,6-dimethoxy-2-(4-methoxypiperidin-1-yl)pyrimidin-5-yl]-4-methylpentanamide is sourced from PubChem (CID 122191418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).