C22H14N2O2S2 — CID 122191438
4-(4-ethylphenyl)sulfanylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione (PubChem CID 122191438) has the molecular formula C22H14N2O2S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 4-(4-ethylphenyl)sulfanylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione.
| Compound Name | 4-(4-ethylphenyl)sulfanylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione |
|---|---|
| PubChem CID | 122191438 |
| Molecular Formula | C22H14N2O2S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-(4-ethylphenyl)sulfanylnaphtho[2,3-g][2,1,3]benzothiadiazole-6,11-dione |
| SMILES | CCc1ccc(Sc2cc3c(c4nsnc24)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H14N2O2S2/c1-2-12-7-9-13(10-8-12)27-17-11-16-18(20-19(17)23-28-24-20)22(26)15-6-4-3-5-14(15)21(16)25/h3-11H,2H2,1H3 |
| InChIKey | FHXHTFBIUGFXJD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|