C14H25IN2O5 — CID 122191538
methyl (2R)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (PubChem CID 122191538) has the molecular formula C14H25IN2O5 and a molecular weight of 428.27 g/mol. Its IUPAC name is methyl (2R)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate.
| Compound Name | methyl (2R)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
|---|---|
| PubChem CID | 122191538 |
| Molecular Formula | C14H25IN2O5 |
| Molecular Weight | 428.27 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | methyl (2R)-2-[(2-iodoacetyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| SMILES | COC(=O)[C@@H](CCCCNC(=O)OC(C)(C)C)NC(=O)CI |
| InChI | InChI=1S/C14H25IN2O5/c1-14(2,3)22-13(20)16-8-6-5-7-10(12(19)21-4)17-11(18)9-15/h10H,5-9H2,1-4H3,(H,16,20)(H,17,18)/t10-/m1/s1 |
| InChIKey | QSXGOSYHJJQGOA-SNVBAGLBSA-N |
| XLogP | 1.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|