C20H15NO5 — CID 122191555
(3R,4S)-4-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione (PubChem CID 122191555) has the molecular formula C20H15NO5 and a molecular weight of 349.34 g/mol. Its IUPAC name is (3R,4S)-4-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione.
| Compound Name | (3R,4S)-4-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 122191555 |
| Molecular Formula | C20H15NO5 |
| Molecular Weight | 349.34 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | (3R,4S)-4-(4-methylphenyl)-3-nitro-3,4-dihydro-2H-benzo[g]chromene-5,10-dione |
| SMILES | Cc1ccc([C@H]2C3=C(OC[C@@H]2[N+](=O)[O-])C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C20H15NO5/c1-11-6-8-12(9-7-11)16-15(21(24)25)10-26-20-17(16)18(22)13-4-2-3-5-14(13)19(20)23/h2-9,15-16H,10H2,1H3/t15-,16+/m0/s1 |
| InChIKey | XKGJYJVVCCLUJV-JKSUJKDBSA-N |
| XLogP | 3.09 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|