C15H18O5 — CID 122191596
(3aS,6S,7aS)-6-methyl-3-methylidene-6-(3-oxopentanoyl)-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione (PubChem CID 122191596) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is (3aS,6S,7aS)-6-methyl-3-methylidene-6-(3-oxopentanoyl)-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione.
| Compound Name | (3aS,6S,7aS)-6-methyl-3-methylidene-6-(3-oxopentanoyl)-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 122191596 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | (3aS,6S,7aS)-6-methyl-3-methylidene-6-(3-oxopentanoyl)-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione |
| SMILES | C=C1C(=O)O[C@H]2C[C@](C)(C(=O)CC(=O)CC)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C15H18O5/c1-4-9(16)5-12(17)15(3)7-11-10(6-13(15)18)8(2)14(19)20-11/h10-11H,2,4-7H2,1,3H3/t10-,11-,15+/m0/s1 |
| InChIKey | QIEUQKALAWSPLL-ZIBATOQPSA-N |
| XLogP | 1.39 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|