C15H16O4 — CID 122191598
(1S,2S,6S,8R)-11-ethyl-8-methyl-3-methylidene-5-oxatricyclo[6.3.1.02,6]dodec-10-ene-4,9,12-trione (PubChem CID 122191598) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is (1S,2S,6S,8R)-11-ethyl-8-methyl-3-methylidene-5-oxatricyclo[6.3.1.02,6]dodec-10-ene-4,9,12-trione.
| Compound Name | (1S,2S,6S,8R)-11-ethyl-8-methyl-3-methylidene-5-oxatricyclo[6.3.1.02,6]dodec-10-ene-4,9,12-trione |
|---|---|
| PubChem CID | 122191598 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (1S,2S,6S,8R)-11-ethyl-8-methyl-3-methylidene-5-oxatricyclo[6.3.1.02,6]dodec-10-ene-4,9,12-trione |
| SMILES | C=C1C(=O)O[C@H]2C[C@]3(C)C(=O)C=C(CC)[C@@H](C3=O)[C@@H]12 |
| InChI | InChI=1S/C15H16O4/c1-4-8-5-10(16)15(3)6-9-11(12(8)13(15)17)7(2)14(18)19-9/h5,9,11-12H,2,4,6H2,1,3H3/t9-,11-,12+,15+/m0/s1 |
| InChIKey | UYIYIVJAMXPCGU-APAOZMKASA-N |
| XLogP | 1.60 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|