C22H29N7O3 — CID 122191620
N,N-dicyclopropyl-10-ethyl-7-(2-methoxyethylcarbamoylamino)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxamide (PubChem CID 122191620) has the molecular formula C22H29N7O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is N,N-dicyclopropyl-10-ethyl-7-(2-methoxyethylcarbamoylamino)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxamide.
| Compound Name | N,N-dicyclopropyl-10-ethyl-7-(2-methoxyethylcarbamoylamino)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxamide |
|---|---|
| PubChem CID | 122191620 |
| Molecular Formula | C22H29N7O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N,N-dicyclopropyl-10-ethyl-7-(2-methoxyethylcarbamoylamino)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene-11-carboxamide |
| SMILES | CCn1c(C(=O)N(C2CC2)C2CC2)cc2c3c(ncn3C)c(NC(=O)NCCOC)nc21 |
| InChI | InChI=1S/C22H29N7O3/c1-4-28-16(21(30)29(13-5-6-13)14-7-8-14)11-15-18-17(24-12-27(18)2)19(25-20(15)28)26-22(31)23-9-10-32-3/h11-14H,4-10H2,1-3H3,(H2,23,25,26,31) |
| InChIKey | CFNPJFCYTRTKMW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 106.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|