C22H26N2O3S3 — CID 122191776
(2R,4'R,6R,9E,13E,15Z)-2,4',9-trimethylspiro[19-thia-3,20-diazabicyclo[15.2.1]icosa-1(20),9,13,15,17-pentaene-6,5'-dithiolane]-3',4,12-trione (PubChem CID 122191776) has the molecular formula C22H26N2O3S3 and a molecular weight of 462.66 g/mol. Its IUPAC name is (2R,4'R,6R,9E,13E,15Z)-2,4',9-trimethylspiro[19-thia-3,20-diazabicyclo[15.2.1]icosa-1(20),9,13,15,17-pentaene-6,5'-dithiolane]-3',4,12-trione.
| Compound Name | (2R,4'R,6R,9E,13E,15Z)-2,4',9-trimethylspiro[19-thia-3,20-diazabicyclo[15.2.1]icosa-1(20),9,13,15,17-pentaene-6,5'-dithiolane]-3',4,12-trione |
|---|---|
| PubChem CID | 122191776 |
| Molecular Formula | C22H26N2O3S3 |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | (2R,4'R,6R,9E,13E,15Z)-2,4',9-trimethylspiro[19-thia-3,20-diazabicyclo[15.2.1]icosa-1(20),9,13,15,17-pentaene-6,5'-dithiolane]-3',4,12-trione |
| SMILES | C/C1=C\CC(=O)/C=C/C=C\c2csc(n2)[C@@H](C)NC(=O)C[C@@]2(CC1)SSC(=O)[C@@H]2C |
| InChI | InChI=1S/C22H26N2O3S3/c1-14-8-9-18(25)7-5-4-6-17-13-28-20(24-17)16(3)23-19(26)12-22(11-10-14)15(2)21(27)29-30-22/h4-8,13,15-16H,9-12H2,1-3H3,(H,23,26)/b6-4-,7-5+,14-8+/t15-,16+,22+/m0/s1 |
| InChIKey | OHNSBMVHBYTGJO-OYRQPNHFSA-N |
| XLogP | 5.28 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|