About [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate
[(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate (PubChem CID 122191908) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate.
Molecular Properties
| Compound Name | [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate |
| PubChem CID | 122191908 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OC[C@H]1C[C@H]1N |
| InChI | InChI=1S/C7H14N2O2/c1-9(2)7(10)11-4-5-3-6(5)8/h5-6H,3-4,8H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | BJQZFRDIRCAVNS-PHDIDXHHSA-N |
| XLogP | 0.03 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate?
The IUPAC name of [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate (CID 122191908) is [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate.
What is the SMILES notation for [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate?
The canonical SMILES for [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate is CN(C)C(=O)OC[C@H]1C[C@H]1N.
What is the InChIKey of [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate?
The InChIKey is BJQZFRDIRCAVNS-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-9(2)7(10)11-4-5-3-6(5)8/h5-6H,3-4,8H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate?
[(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate has a molecular weight of 158.20 g/mol, XLogP of 0.03, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-aminocyclopropyl]methyl N,N-dimethylcarbamate is sourced from PubChem (CID 122191908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).