About 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole
5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole (PubChem CID 122191966) has the molecular formula C35H24BrN3
and a molecular weight of 566.50 g/mol. Its IUPAC name is 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole.
Molecular Properties
| Compound Name | 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole |
| PubChem CID | 122191966 |
| Molecular Formula | C35H24BrN3 |
| Molecular Weight | 566.50 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole |
| SMILES | Brc1ccc2[nH]c(-c3ccccc3)c(-c3nc(-c4ccccc4)c(-c4ccccc4)n3-c3ccccc3)c2c1 |
| InChI | InChI=1S/C35H24BrN3/c36-27-21-22-30-29(23-27)31(32(37-30)24-13-5-1-6-14-24)35-38-33(25-15-7-2-8-16-25)34(26-17-9-3-10-18-26)39(35)28-19-11-4-12-20-28/h1-23,37H |
| InChIKey | FVPSAVQIAUUJOL-UHFFFAOYSA-N |
| XLogP | 9.78 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.50 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole?
The IUPAC name of 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole (CID 122191966) is 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole.
What is the SMILES notation for 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole?
The canonical SMILES for 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole is Brc1ccc2[nH]c(-c3ccccc3)c(-c3nc(-c4ccccc4)c(-c4ccccc4)n3-c3ccccc3)c2c1.
What is the InChIKey of 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole?
The InChIKey is FVPSAVQIAUUJOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H24BrN3/c36-27-21-22-30-29(23-27)31(32(37-30)24-13-5-1-6-14-24)35-38-33(25-15-7-2-8-16-25)34(26-17-9-3-10-18-26)39(35)28-19-11-4-12-20-28/h1-23,37H.
What are the key properties of 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole?
5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole has a molecular weight of 566.50 g/mol, XLogP of 9.78, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-phenyl-3-(1,4,5-triphenylimidazol-2-yl)-1H-indole is sourced from PubChem (CID 122191966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).