About 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one
3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one (PubChem CID 122192027) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one.
Molecular Properties
| Compound Name | 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one |
| PubChem CID | 122192027 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one |
| SMILES | CCCn1ccnc1/C=C/C(=O)/C=C/c1coc2ccccc2c1=O |
| InChI | InChI=1S/C20H18N2O3/c1-2-12-22-13-11-21-19(22)10-9-16(23)8-7-15-14-25-18-6-4-3-5-17(18)20(15)24/h3-11,13-14H,2,12H2,1H3/b8-7+,10-9+ |
| InChIKey | UWPDIVFAUIHPKH-XBLVEGMJSA-N |
| XLogP | 3.70 |
| TPSA | 65.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one?
The IUPAC name of 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one (CID 122192027) is 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one.
What is the SMILES notation for 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one?
The canonical SMILES for 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one is CCCn1ccnc1/C=C/C(=O)/C=C/c1coc2ccccc2c1=O.
What is the InChIKey of 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one?
The InChIKey is UWPDIVFAUIHPKH-XBLVEGMJSA-N. The full InChI is InChI=1S/C20H18N2O3/c1-2-12-22-13-11-21-19(22)10-9-16(23)8-7-15-14-25-18-6-4-3-5-17(18)20(15)24/h3-11,13-14H,2,12H2,1H3/b8-7+,10-9+.
What are the key properties of 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one?
3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one has a molecular weight of 334.38 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1E,4E)-3-oxo-5-(1-propylimidazol-2-yl)penta-1,4-dienyl]chromen-4-one is sourced from PubChem (CID 122192027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).