About 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol
1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol (PubChem CID 122192140) has the molecular formula C21H25N5O
and a molecular weight of 363.47 g/mol. Its IUPAC name is 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol.
Molecular Properties
| Compound Name | 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol |
| PubChem CID | 122192140 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol |
| SMILES | Cc1cc(C)cc(Nc2nccc(-n3cc(C)c(CN4CC(O)C4)c3)n2)c1 |
| InChI | InChI=1S/C21H25N5O/c1-14-6-15(2)8-18(7-14)23-21-22-5-4-20(24-21)26-9-16(3)17(11-26)10-25-12-19(27)13-25/h4-9,11,19,27H,10,12-13H2,1-3H3,(H,22,23,24) |
| InChIKey | SPPKMJFTYUFSBQ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol?
The IUPAC name of 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol (CID 122192140) is 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol.
What is the SMILES notation for 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol?
The canonical SMILES for 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol is Cc1cc(C)cc(Nc2nccc(-n3cc(C)c(CN4CC(O)C4)c3)n2)c1.
What is the InChIKey of 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol?
The InChIKey is SPPKMJFTYUFSBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N5O/c1-14-6-15(2)8-18(7-14)23-21-22-5-4-20(24-21)26-9-16(3)17(11-26)10-25-12-19(27)13-25/h4-9,11,19,27H,10,12-13H2,1-3H3,(H,22,23,24).
What are the key properties of 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol?
1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol has a molecular weight of 363.47 g/mol, XLogP of 3.11, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[1-[2-(3,5-dimethylanilino)pyrimidin-4-yl]-4-methylpyrrol-3-yl]methyl]azetidin-3-ol is sourced from PubChem (CID 122192140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).