C17H16ClN5O5 — CID 122192178
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-chlorobenzoate (PubChem CID 122192178) has the molecular formula C17H16ClN5O5 and a molecular weight of 405.80 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-chlorobenzoate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-chlorobenzoate |
|---|---|
| PubChem CID | 122192178 |
| Molecular Formula | C17H16ClN5O5 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl 3-chlorobenzoate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(=O)c2cccc(Cl)c2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H16ClN5O5/c18-9-3-1-2-8(4-9)17(26)27-5-10-12(24)13(25)16(28-10)23-7-22-11-14(19)20-6-21-15(11)23/h1-4,6-7,10,12-13,16,24-25H,5H2,(H2,19,20,21)/t10-,12-,13-,16-/m1/s1 |
| InChIKey | MQXDCGQSMZFPIB-XNIJJKJLSA-N |
| XLogP | 0.54 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |