C20H21ClN2O — CID 122192183
2-[(1R,3R)-1-(4-chlorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol (PubChem CID 122192183) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 2-[(1R,3R)-1-(4-chlorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol.
| Compound Name | 2-[(1R,3R)-1-(4-chlorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol |
|---|---|
| PubChem CID | 122192183 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[(1R,3R)-1-(4-chlorophenyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]ethanol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(Cl)cc2)N1CCO |
| InChI | InChI=1S/C20H21ClN2O/c1-13-12-17-16-4-2-3-5-18(16)22-19(17)20(23(13)10-11-24)14-6-8-15(21)9-7-14/h2-9,13,20,22,24H,10-12H2,1H3/t13-,20-/m1/s1 |
| InChIKey | AMHQHODPRWKKPO-ZUOKHONESA-N |
| XLogP | 4.15 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|