About 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide
1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide (PubChem CID 122192205) has the molecular formula C19H19ClN2O3
and a molecular weight of 358.83 g/mol. Its IUPAC name is 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide.
Molecular Properties
| Compound Name | 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide |
| PubChem CID | 122192205 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide |
| SMILES | CN(C)C(=O)C1Cc2ccccc2N1C(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O3/c1-21(2)19(24)17-11-13-5-3-4-6-16(13)22(17)18(23)12-25-15-9-7-14(20)8-10-15/h3-10,17H,11-12H2,1-2H3 |
| InChIKey | HHHHQHKXHVAJGM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide?
The IUPAC name of 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide (CID 122192205) is 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide.
What is the SMILES notation for 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide?
The canonical SMILES for 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide is CN(C)C(=O)C1Cc2ccccc2N1C(=O)COc1ccc(Cl)cc1.
What is the InChIKey of 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide?
The InChIKey is HHHHQHKXHVAJGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O3/c1-21(2)19(24)17-11-13-5-3-4-6-16(13)22(17)18(23)12-25-15-9-7-14(20)8-10-15/h3-10,17H,11-12H2,1-2H3.
What are the key properties of 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide?
1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide has a molecular weight of 358.83 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-chlorophenoxy)acetyl]-N,N-dimethyl-2,3-dihydroindole-2-carboxamide is sourced from PubChem (CID 122192205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).