C31H31ClN4O5S — CID 122192247
2-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide (PubChem CID 122192247) has the molecular formula C31H31ClN4O5S and a molecular weight of 607.13 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 122192247 |
| Molecular Formula | C31H31ClN4O5S |
| Molecular Weight | 607.13 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | 2-chloro-N-[2-[3-[[5-[3-(dimethylcarbamoyl)phenyl]-2-methoxyphenyl]sulfonylamino]anilino]ethyl]benzamide |
| SMILES | COc1ccc(-c2cccc(C(=O)N(C)C)c2)cc1S(=O)(=O)Nc1cccc(NCCNC(=O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C31H31ClN4O5S/c1-36(2)31(38)23-9-6-8-21(18-23)22-14-15-28(41-3)29(19-22)42(39,40)35-25-11-7-10-24(20-25)33-16-17-34-30(37)26-12-4-5-13-27(26)32/h4-15,18-20,33,35H,16-17H2,1-3H3,(H,34,37) |
| InChIKey | ICZLKTQSCUPWPB-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.13 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|