About 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile
4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile (PubChem CID 122192266) has the molecular formula C23H14N2O2
and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile |
| PubChem CID | 122192266 |
| Molecular Formula | C23H14N2O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/c2ccccc2N2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C23H14N2O2/c24-15-17-11-9-16(10-12-17)13-14-18-5-1-4-8-21(18)25-22(26)19-6-2-3-7-20(19)23(25)27/h1-14H/b14-13+ |
| InChIKey | QRRHIDZEDDNRNY-BUHFOSPRSA-N |
| XLogP | 4.53 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile?
The IUPAC name of 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile (CID 122192266) is 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile.
What is the SMILES notation for 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile?
The canonical SMILES for 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile is N#Cc1ccc(/C=C/c2ccccc2N2C(=O)c3ccccc3C2=O)cc1.
What is the InChIKey of 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile?
The InChIKey is QRRHIDZEDDNRNY-BUHFOSPRSA-N. The full InChI is InChI=1S/C23H14N2O2/c24-15-17-11-9-16(10-12-17)13-14-18-5-1-4-8-21(18)25-22(26)19-6-2-3-7-20(19)23(25)27/h1-14H/b14-13+.
What are the key properties of 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile?
4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile has a molecular weight of 350.38 g/mol, XLogP of 4.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[2-(1,3-dioxoisoindol-2-yl)phenyl]ethenyl]benzonitrile is sourced from PubChem (CID 122192266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).