C14H17N3O4S — CID 122192532
N-(2-acetamidoethyl)-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide (PubChem CID 122192532) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
|---|---|
| PubChem CID | 122192532 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-(2-acetamidoethyl)-2-methyl-1,1-dioxo-1λ6,2-benzothiazine-3-carboxamide |
| SMILES | CC(=O)NCCNC(=O)C1=Cc2ccccc2S(=O)(=O)N1C |
| InChI | InChI=1S/C14H17N3O4S/c1-10(18)15-7-8-16-14(19)12-9-11-5-3-4-6-13(11)22(20,21)17(12)2/h3-6,9H,7-8H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | UDODXCYVXSODAS-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|