C43H49N5O5 — CID 122192544
9H-fluoren-9-ylmethyl N-[(5S)-6-[(2S)-2-(benzhydrylcarbamoyl)pyrrolidin-1-yl]-5-[[(2S)-2-(methylamino)propanoyl]amino]-6-oxohexyl]carbamate (PubChem CID 122192544) has the molecular formula C43H49N5O5 and a molecular weight of 715.90 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(5S)-6-[(2S)-2-(benzhydrylcarbamoyl)pyrrolidin-1-yl]-5-[[(2S)-2-(methylamino)propanoyl]amino]-6-oxohexyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(5S)-6-[(2S)-2-(benzhydrylcarbamoyl)pyrrolidin-1-yl]-5-[[(2S)-2-(methylamino)propanoyl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 122192544 |
| Molecular Formula | C43H49N5O5 |
| Molecular Weight | 715.90 g/mol |
| Exact Mass | 715.37 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(5S)-6-[(2S)-2-(benzhydrylcarbamoyl)pyrrolidin-1-yl]-5-[[(2S)-2-(methylamino)propanoyl]amino]-6-oxohexyl]carbamate |
| SMILES | CN[C@@H](C)C(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCC[C@H]1C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H49N5O5/c1-29(44-2)40(49)46-37(24-13-14-26-45-43(52)53-28-36-34-22-11-9-20-32(34)33-21-10-12-23-35(33)36)42(51)48-27-15-25-38(48)41(50)47-39(30-16-5-3-6-17-30)31-18-7-4-8-19-31/h3-12,16-23,29,36-39,44H,13-15,24-28H2,1-2H3,(H,45,52)(H,46,49)(H,47,50)/t29-,37-,38-/m0/s1 |
| InChIKey | SKDGVSHKHIHUQY-XHNBAOFPSA-N |
| XLogP | 5.68 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|