C18H16N2O5 — CID 122192568
ethyl 1,6,11-trioxo-2,3,4,13-tetrahydroindazolo[1,2-b]phthalazine-13-carboxylate (PubChem CID 122192568) has the molecular formula C18H16N2O5 and a molecular weight of 340.34 g/mol. Its IUPAC name is ethyl 1,6,11-trioxo-2,3,4,13-tetrahydroindazolo[1,2-b]phthalazine-13-carboxylate.
| Compound Name | ethyl 1,6,11-trioxo-2,3,4,13-tetrahydroindazolo[1,2-b]phthalazine-13-carboxylate |
|---|---|
| PubChem CID | 122192568 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | ethyl 1,6,11-trioxo-2,3,4,13-tetrahydroindazolo[1,2-b]phthalazine-13-carboxylate |
| SMILES | CCOC(=O)C1C2=C(CCCC2=O)n2c(=O)c3ccccc3c(=O)n21 |
| InChI | InChI=1S/C18H16N2O5/c1-2-25-18(24)15-14-12(8-5-9-13(14)21)19-16(22)10-6-3-4-7-11(10)17(23)20(15)19/h3-4,6-7,15H,2,5,8-9H2,1H3 |
| InChIKey | GSLPTKMWMPJEJW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |