C25H29N7O2 — CID 122192910
(2S)-2-[3-[4-[4-(2-phenylacetyl)piperazin-1-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide (PubChem CID 122192910) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is (2S)-2-[3-[4-[4-(2-phenylacetyl)piperazin-1-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide.
| Compound Name | (2S)-2-[3-[4-[4-(2-phenylacetyl)piperazin-1-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 122192910 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | (2S)-2-[3-[4-[4-(2-phenylacetyl)piperazin-1-yl]phenyl]-1,2,4-oxadiazol-5-yl]pyrrolidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCC[C@H]1c1nc(-c2ccc(N3CCN(C(=O)Cc4ccccc4)CC3)cc2)no1 |
| InChI | InChI=1S/C25H29N7O2/c26-25(27)32-12-4-7-21(32)24-28-23(29-34-24)19-8-10-20(11-9-19)30-13-15-31(16-14-30)22(33)17-18-5-2-1-3-6-18/h1-3,5-6,8-11,21H,4,7,12-17H2,(H3,26,27)/t21-/m0/s1 |
| InChIKey | UCXPSJXBISHJAK-NRFANRHFSA-N |
| XLogP | 2.66 |
| TPSA | 115.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|