C26H35N5O2S2 — CID 122192967
N'-[[(2S)-4-(1-benzothiophen-2-ylsulfonyl)piperazin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine (PubChem CID 122192967) has the molecular formula C26H35N5O2S2 and a molecular weight of 513.73 g/mol. Its IUPAC name is N'-[[(2S)-4-(1-benzothiophen-2-ylsulfonyl)piperazin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine.
| Compound Name | N'-[[(2S)-4-(1-benzothiophen-2-ylsulfonyl)piperazin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 122192967 |
| Molecular Formula | C26H35N5O2S2 |
| Molecular Weight | 513.73 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | N'-[[(2S)-4-(1-benzothiophen-2-ylsulfonyl)piperazin-2-yl]methyl]-N'-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]butane-1,4-diamine |
| SMILES | NCCCCN(C[C@H]1CN(S(=O)(=O)c2cc3ccccc3s2)CCN1)[C@H]1CCCc2cccnc21 |
| InChI | InChI=1S/C26H35N5O2S2/c27-12-3-4-15-30(23-10-5-8-20-9-6-13-29-26(20)23)18-22-19-31(16-14-28-22)35(32,33)25-17-21-7-1-2-11-24(21)34-25/h1-2,6-7,9,11,13,17,22-23,28H,3-5,8,10,12,14-16,18-19,27H2/t22-,23-/m0/s1 |
| InChIKey | MNNBALJLXVSZMB-GOTSBHOMSA-N |
| XLogP | 3.38 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.73 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|