C22H25Cl2N5O3 — CID 122193039
(2S)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-(3-methoxyphenyl)pyrrolidine-2-carboxamide (PubChem CID 122193039) has the molecular formula C22H25Cl2N5O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is (2S)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-(3-methoxyphenyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-(3-methoxyphenyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122193039 |
| Molecular Formula | C22H25Cl2N5O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | (2S)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-(3-methoxyphenyl)pyrrolidine-2-carboxamide |
| SMILES | COc1cccc(N2CCC[C@H]2C(=O)N/C(N)=N/Cc2cc(Cl)c(NC(C)=O)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H25Cl2N5O3/c1-13(30)27-20-17(23)9-14(10-18(20)24)12-26-22(25)28-21(31)19-7-4-8-29(19)15-5-3-6-16(11-15)32-2/h3,5-6,9-11,19H,4,7-8,12H2,1-2H3,(H,27,30)(H3,25,26,28,31)/t19-/m0/s1 |
| InChIKey | XCMIRMNZMAETLZ-IBGZPJMESA-N |
| XLogP | 3.56 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|