C28H29Cl2N5O3 — CID 122193045
(2S,4R)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-phenyl-4-phenylmethoxypyrrolidine-2-carboxamide (PubChem CID 122193045) has the molecular formula C28H29Cl2N5O3 and a molecular weight of 554.48 g/mol. Its IUPAC name is (2S,4R)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-phenyl-4-phenylmethoxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-phenyl-4-phenylmethoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 122193045 |
| Molecular Formula | C28H29Cl2N5O3 |
| Molecular Weight | 554.48 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | (2S,4R)-N-[N'-[(4-acetamido-3,5-dichlorophenyl)methyl]carbamimidoyl]-1-phenyl-4-phenylmethoxypyrrolidine-2-carboxamide |
| SMILES | CC(=O)Nc1c(Cl)cc(C/N=C(\N)NC(=O)[C@@H]2C[C@@H](OCc3ccccc3)CN2c2ccccc2)cc1Cl |
| InChI | InChI=1S/C28H29Cl2N5O3/c1-18(36)33-26-23(29)12-20(13-24(26)30)15-32-28(31)34-27(37)25-14-22(38-17-19-8-4-2-5-9-19)16-35(25)21-10-6-3-7-11-21/h2-13,22,25H,14-17H2,1H3,(H,33,36)(H3,31,32,34,37)/t22-,25+/m1/s1 |
| InChIKey | GNFFCOREKIKKBF-RDGATRHJSA-N |
| XLogP | 4.75 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.48 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|