C25H28Cl2N6O3 — CID 122193184
(6S,21E)-9-amino-14,30-dichloro-24-oxa-2,8,10,16,19-pentazatetracyclo[23.2.2.212,15.02,6]hentriaconta-1(27),9,12,14,21,25,28,30-octaene-7,17-dione (PubChem CID 122193184) has the molecular formula C25H28Cl2N6O3 and a molecular weight of 531.44 g/mol. Its IUPAC name is (6S,21E)-9-amino-14,30-dichloro-24-oxa-2,8,10,16,19-pentazatetracyclo[23.2.2.212,15.02,6]hentriaconta-1(27),9,12,14,21,25,28,30-octaene-7,17-dione.
| Compound Name | (6S,21E)-9-amino-14,30-dichloro-24-oxa-2,8,10,16,19-pentazatetracyclo[23.2.2.212,15.02,6]hentriaconta-1(27),9,12,14,21,25,28,30-octaene-7,17-dione |
|---|---|
| PubChem CID | 122193184 |
| Molecular Formula | C25H28Cl2N6O3 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (6S,21E)-9-amino-14,30-dichloro-24-oxa-2,8,10,16,19-pentazatetracyclo[23.2.2.212,15.02,6]hentriaconta-1(27),9,12,14,21,25,28,30-octaene-7,17-dione |
| SMILES | N/C1=N/Cc2cc(Cl)c(c(Cl)c2)NC(=O)CNC/C=C/COc2ccc(cc2)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C25H28Cl2N6O3/c26-19-12-16-13-20(27)23(19)31-22(34)15-29-9-1-2-11-36-18-7-5-17(6-8-18)33-10-3-4-21(33)24(35)32-25(28)30-14-16/h1-2,5-8,12-13,21,29H,3-4,9-11,14-15H2,(H,31,34)(H3,28,30,32,35)/b2-1+/t21-/m0/s1 |
| InChIKey | QZVULTBRCJQMMO-BTFLMBNSSA-N |
| XLogP | 3.07 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|