C26H30Cl2N6O3 — CID 122193185
(6S,22E)-9-amino-14,31-dichloro-25-oxa-2,8,10,16,19-pentazatetracyclo[24.2.2.212,15.02,6]dotriaconta-1(28),9,12,14,22,26,29,31-octaene-7,17-dione (PubChem CID 122193185) has the molecular formula C26H30Cl2N6O3 and a molecular weight of 545.47 g/mol. Its IUPAC name is (6S,22E)-9-amino-14,31-dichloro-25-oxa-2,8,10,16,19-pentazatetracyclo[24.2.2.212,15.02,6]dotriaconta-1(28),9,12,14,22,26,29,31-octaene-7,17-dione.
| Compound Name | (6S,22E)-9-amino-14,31-dichloro-25-oxa-2,8,10,16,19-pentazatetracyclo[24.2.2.212,15.02,6]dotriaconta-1(28),9,12,14,22,26,29,31-octaene-7,17-dione |
|---|---|
| PubChem CID | 122193185 |
| Molecular Formula | C26H30Cl2N6O3 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (6S,22E)-9-amino-14,31-dichloro-25-oxa-2,8,10,16,19-pentazatetracyclo[24.2.2.212,15.02,6]dotriaconta-1(28),9,12,14,22,26,29,31-octaene-7,17-dione |
| SMILES | N/C1=N/Cc2cc(Cl)c(c(Cl)c2)NC(=O)CNCC/C=C/COc2ccc(cc2)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C26H30Cl2N6O3/c27-20-13-17-14-21(28)24(20)32-23(35)16-30-10-2-1-3-12-37-19-8-6-18(7-9-19)34-11-4-5-22(34)25(36)33-26(29)31-15-17/h1,3,6-9,13-14,22,30H,2,4-5,10-12,15-16H2,(H,32,35)(H3,29,31,33,36)/b3-1+/t22-/m0/s1 |
| InChIKey | INHHPEGPWFCJLB-WHLCUDGSSA-N |
| XLogP | 3.46 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|