C27H32Cl2N6O3 — CID 122193187
(6S,23E)-9-amino-14,32-dichloro-26-oxa-2,8,10,16,19-pentazatetracyclo[25.2.2.212,15.02,6]tritriaconta-1(29),9,12,14,23,27,30,32-octaene-7,17-dione (PubChem CID 122193187) has the molecular formula C27H32Cl2N6O3 and a molecular weight of 559.50 g/mol. Its IUPAC name is (6S,23E)-9-amino-14,32-dichloro-26-oxa-2,8,10,16,19-pentazatetracyclo[25.2.2.212,15.02,6]tritriaconta-1(29),9,12,14,23,27,30,32-octaene-7,17-dione.
| Compound Name | (6S,23E)-9-amino-14,32-dichloro-26-oxa-2,8,10,16,19-pentazatetracyclo[25.2.2.212,15.02,6]tritriaconta-1(29),9,12,14,23,27,30,32-octaene-7,17-dione |
|---|---|
| PubChem CID | 122193187 |
| Molecular Formula | C27H32Cl2N6O3 |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 558.19 |
| IUPAC Name | (6S,23E)-9-amino-14,32-dichloro-26-oxa-2,8,10,16,19-pentazatetracyclo[25.2.2.212,15.02,6]tritriaconta-1(29),9,12,14,23,27,30,32-octaene-7,17-dione |
| SMILES | N/C1=N\Cc2cc(Cl)c(c(Cl)c2)NC(=O)CNCCC/C=C/COc2ccc(cc2)N2CCC[C@H]2C(=O)N1 |
| InChI | InChI=1S/C27H32Cl2N6O3/c28-21-14-18-15-22(29)25(21)33-24(36)17-31-11-3-1-2-4-13-38-20-9-7-19(8-10-20)35-12-5-6-23(35)26(37)34-27(30)32-16-18/h2,4,7-10,14-15,23,31H,1,3,5-6,11-13,16-17H2,(H,33,36)(H3,30,32,34,37)/b4-2+/t23-/m0/s1 |
| InChIKey | XAPZEJASZMKPEN-ZGVNINRLSA-N |
| XLogP | 3.85 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|