About 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine
2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 122193193) has the molecular formula C19H18N6
and a molecular weight of 330.39 g/mol. Its IUPAC name is 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 122193193 |
| Molecular Formula | C19H18N6 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCc2cnccn2)n2nc(C)c(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C19H18N6/c1-13-10-17(22-12-16-11-20-8-9-21-16)25-19(23-13)18(14(2)24-25)15-6-4-3-5-7-15/h3-11,22H,12H2,1-2H3 |
| InChIKey | LCRPCJNULHYBLY-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine (CID 122193193) is 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine is Cc1cc(NCc2cnccn2)n2nc(C)c(-c3ccccc3)c2n1.
What is the InChIKey of 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is LCRPCJNULHYBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N6/c1-13-10-17(22-12-16-11-20-8-9-21-16)25-19(23-13)18(14(2)24-25)15-6-4-3-5-7-15/h3-11,22H,12H2,1-2H3.
What are the key properties of 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine?
2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 330.39 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-3-phenyl-N-(pyrazin-2-ylmethyl)pyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 122193193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).