C29H34N6O4 — CID 122193250
N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl]benzamide (PubChem CID 122193250) has the molecular formula C29H34N6O4 and a molecular weight of 530.63 g/mol. Its IUPAC name is N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl]benzamide |
|---|---|
| PubChem CID | 122193250 |
| Molecular Formula | C29H34N6O4 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | N-[(2S)-1-[[(2S)-6-amino-1-[[(1S)-2-amino-2-oxo-1-phenylethyl]amino]-1-oxohexan-2-yl]amino]-1-oxo-3-pyridin-4-ylpropan-2-yl]benzamide |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1ccncc1)NC(=O)c1ccccc1)C(=O)N[C@H](C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C29H34N6O4/c30-16-8-7-13-23(28(38)35-25(26(31)36)21-9-3-1-4-10-21)33-29(39)24(19-20-14-17-32-18-15-20)34-27(37)22-11-5-2-6-12-22/h1-6,9-12,14-15,17-18,23-25H,7-8,13,16,19,30H2,(H2,31,36)(H,33,39)(H,34,37)(H,35,38)/t23-,24-,25-/m0/s1 |
| InChIKey | LXOCVTAXUYTNTO-SDHOMARFSA-N |
| XLogP | 1.38 |
| TPSA | 169.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|