C26H23ClN4O4 — CID 122193273
5-[2-(4-chloroimidazo[4,5-c]pyridin-3-yl)ethyl]-5-hydroxy-3,4-bis(phenylmethoxy)-1H-pyrrol-2-one (PubChem CID 122193273) has the molecular formula C26H23ClN4O4 and a molecular weight of 490.95 g/mol. Its IUPAC name is 5-[2-(4-chloroimidazo[4,5-c]pyridin-3-yl)ethyl]-5-hydroxy-3,4-bis(phenylmethoxy)-1H-pyrrol-2-one.
| Compound Name | 5-[2-(4-chloroimidazo[4,5-c]pyridin-3-yl)ethyl]-5-hydroxy-3,4-bis(phenylmethoxy)-1H-pyrrol-2-one |
|---|---|
| PubChem CID | 122193273 |
| Molecular Formula | C26H23ClN4O4 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 5-[2-(4-chloroimidazo[4,5-c]pyridin-3-yl)ethyl]-5-hydroxy-3,4-bis(phenylmethoxy)-1H-pyrrol-2-one |
| SMILES | O=C1NC(O)(CCn2cnc3ccnc(Cl)c32)C(OCc2ccccc2)=C1OCc1ccccc1 |
| InChI | InChI=1S/C26H23ClN4O4/c27-24-21-20(11-13-28-24)29-17-31(21)14-12-26(33)23(35-16-19-9-5-2-6-10-19)22(25(32)30-26)34-15-18-7-3-1-4-8-18/h1-11,13,17,33H,12,14-16H2,(H,30,32) |
| InChIKey | NUSUKSVSPVAASE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|