C25H40N4O7S — CID 122193363
S-[(E)-4-[(6R,9R,12R,16S)-9-ethyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate (PubChem CID 122193363) has the molecular formula C25H40N4O7S and a molecular weight of 540.68 g/mol. Its IUPAC name is S-[(E)-4-[(6R,9R,12R,16S)-9-ethyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate.
| Compound Name | S-[(E)-4-[(6R,9R,12R,16S)-9-ethyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate |
|---|---|
| PubChem CID | 122193363 |
| Molecular Formula | C25H40N4O7S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | S-[(E)-4-[(6R,9R,12R,16S)-9-ethyl-2,5,8,11,14-pentaoxo-6,12-di(propan-2-yl)-1-oxa-4,7,10,13-tetrazacyclohexadec-16-yl]but-3-enyl] ethanethioate |
| SMILES | CC[C@H]1NC(=O)[C@@H](C(C)C)NC(=O)C[C@@H](/C=C/CCSC(C)=O)OC(=O)CNC(=O)[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C25H40N4O7S/c1-7-18-23(33)29-21(14(2)3)24(34)26-13-20(32)36-17(10-8-9-11-37-16(6)30)12-19(31)28-22(15(4)5)25(35)27-18/h8,10,14-15,17-18,21-22H,7,9,11-13H2,1-6H3,(H,26,34)(H,27,35)(H,28,31)(H,29,33)/b10-8+/t17-,18-,21-,22-/m1/s1 |
| InChIKey | DURCZQKZLVCYBZ-YXJNUVQQSA-N |
| XLogP | 0.82 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|