About 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine
7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine (PubChem CID 122193408) has the molecular formula C16H10ClN5
and a molecular weight of 307.74 g/mol. Its IUPAC name is 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine |
| PubChem CID | 122193408 |
| Molecular Formula | C16H10ClN5 |
| Molecular Weight | 307.74 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine |
| SMILES | Clc1ccc(-c2c[nH]c3ncc(-c4ccncc4)nc23)cn1 |
| InChI | InChI=1S/C16H10ClN5/c17-14-2-1-11(7-19-14)12-8-20-16-15(12)22-13(9-21-16)10-3-5-18-6-4-10/h1-9H,(H,20,21) |
| InChIKey | NZTXIELVEWGKJA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.74 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine?
The IUPAC name of 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine (CID 122193408) is 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine is Clc1ccc(-c2c[nH]c3ncc(-c4ccncc4)nc23)cn1.
What is the InChIKey of 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine?
The InChIKey is NZTXIELVEWGKJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN5/c17-14-2-1-11(7-19-14)12-8-20-16-15(12)22-13(9-21-16)10-3-5-18-6-4-10/h1-9H,(H,20,21).
What are the key properties of 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine?
7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine has a molecular weight of 307.74 g/mol, XLogP of 3.74, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(6-chloro-3-pyridinyl)-2-pyridin-4-yl-5H-pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 122193408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).