C28H34F3N5O2 — CID 122193452
ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylamino]anilino]-6-(trifluoromethyl)quinoline-3-carboxylate (PubChem CID 122193452) has the molecular formula C28H34F3N5O2 and a molecular weight of 529.61 g/mol. Its IUPAC name is ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylamino]anilino]-6-(trifluoromethyl)quinoline-3-carboxylate.
| Compound Name | ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylamino]anilino]-6-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 122193452 |
| Molecular Formula | C28H34F3N5O2 |
| Molecular Weight | 529.61 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | ethyl 4-[4-[3-(4-ethylpiperazin-1-yl)propylamino]anilino]-6-(trifluoromethyl)quinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2ccc(C(F)(F)F)cc2c1Nc1ccc(NCCCN2CCN(CC)CC2)cc1 |
| InChI | InChI=1S/C28H34F3N5O2/c1-3-35-14-16-36(17-15-35)13-5-12-32-21-7-9-22(10-8-21)34-26-23-18-20(28(29,30)31)6-11-25(23)33-19-24(26)27(37)38-4-2/h6-11,18-19,32H,3-5,12-17H2,1-2H3,(H,33,34) |
| InChIKey | JXMKJNIOAIGALY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|