C32H38N2O4 — CID 122193558
(2S)-2-[[5-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-(1H-indol-2-yl)propanoic acid (PubChem CID 122193558) has the molecular formula C32H38N2O4 and a molecular weight of 514.67 g/mol. Its IUPAC name is (2S)-2-[[5-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-(1H-indol-2-yl)propanoic acid.
| Compound Name | (2S)-2-[[5-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-(1H-indol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 122193558 |
| Molecular Formula | C32H38N2O4 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | (2S)-2-[[5-[[(1R,2S,4aS,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]-3-(1H-indol-2-yl)propanoic acid |
| SMILES | CC1=CCC[C@H]2[C@](C)(CC3=CC(=O)C=C(N[C@@H](Cc4cc5ccccc5[nH]4)C(=O)O)C3=O)[C@@H](C)CC[C@]12C |
| InChI | InChI=1S/C32H38N2O4/c1-19-8-7-11-28-31(19,3)13-12-20(2)32(28,4)18-22-15-24(35)17-26(29(22)36)34-27(30(37)38)16-23-14-21-9-5-6-10-25(21)33-23/h5-6,8-10,14-15,17,20,27-28,33-34H,7,11-13,16,18H2,1-4H3,(H,37,38)/t20-,27-,28+,31+,32+/m0/s1 |
| InChIKey | NBZKWCPDUIUKQT-NOGSXBFYSA-N |
| XLogP | 5.90 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|