About 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide
3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide (PubChem CID 122193592) has the molecular formula C22H20N4O3
and a molecular weight of 388.43 g/mol. Its IUPAC name is 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide |
| PubChem CID | 122193592 |
| Molecular Formula | C22H20N4O3 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(Cn2nnc3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C22H20N4O3/c1-3-25(4-2)22(29)15-9-7-8-14(12-15)13-26-19-18(23-24-26)20(27)16-10-5-6-11-17(16)21(19)28/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | XLQTVKBGJXZUCR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 85.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide?
The IUPAC name of 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide (CID 122193592) is 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide.
What is the SMILES notation for 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide?
The canonical SMILES for 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide is CCN(CC)C(=O)c1cccc(Cn2nnc3c2C(=O)c2ccccc2C3=O)c1.
What is the InChIKey of 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide?
The InChIKey is XLQTVKBGJXZUCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N4O3/c1-3-25(4-2)22(29)15-9-7-8-14(12-15)13-26-19-18(23-24-26)20(27)16-10-5-6-11-17(16)21(19)28/h5-12H,3-4,13H2,1-2H3.
What are the key properties of 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide?
3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide has a molecular weight of 388.43 g/mol, XLogP of 2.58, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,9-dioxobenzo[f]benzotriazol-3-yl)methyl]-N,N-diethylbenzamide is sourced from PubChem (CID 122193592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).