C29H27FN4O3 — CID 122193708
4-[2-(2-fluoroethoxy)ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline (PubChem CID 122193708) has the molecular formula C29H27FN4O3 and a molecular weight of 498.56 g/mol. Its IUPAC name is 4-[2-(2-fluoroethoxy)ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline.
| Compound Name | 4-[2-(2-fluoroethoxy)ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 122193708 |
| Molecular Formula | C29H27FN4O3 |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | 4-[2-(2-fluoroethoxy)ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-3-yl)phenoxy]methyl]quinoline |
| SMILES | Cn1cc(-c2ccncc2)c(-c2ccc(OCc3cc(OCCOCCF)c4ccccc4n3)cc2)n1 |
| InChI | InChI=1S/C29H27FN4O3/c1-34-19-26(21-10-13-31-14-11-21)29(33-34)22-6-8-24(9-7-22)37-20-23-18-28(36-17-16-35-15-12-30)25-4-2-3-5-27(25)32-23/h2-11,13-14,18-19H,12,15-17,20H2,1H3 |
| InChIKey | UWKQLVTVYOHHBY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|