C23H22Cl2N6O — CID 122193792
2,6-dichloro-N-[(2R)-2,8-dimethyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide (PubChem CID 122193792) has the molecular formula C23H22Cl2N6O and a molecular weight of 469.38 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2R)-2,8-dimethyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(2R)-2,8-dimethyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122193792 |
| Molecular Formula | C23H22Cl2N6O |
| Molecular Weight | 469.38 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2,6-dichloro-N-[(2R)-2,8-dimethyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1ccc2c3c(nn2c1)CC[C@@](C)(NC(=O)c1c(Cl)cc(-n2cnc(C)n2)cc1Cl)C3 |
| InChI | InChI=1S/C23H22Cl2N6O/c1-13-4-5-20-16-10-23(3,7-6-19(16)29-30(20)11-13)27-22(32)21-17(24)8-15(9-18(21)25)31-12-26-14(2)28-31/h4-5,8-9,11-12H,6-7,10H2,1-3H3,(H,27,32)/t23-/m1/s1 |
| InChIKey | BTLLBQAWERPXAO-HSZRJFAPSA-N |
| XLogP | 4.52 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.38 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |