C23H22Cl2N6O2 — CID 122193798
2,6-dichloro-N-[(2R)-2-(hydroxymethyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide (PubChem CID 122193798) has the molecular formula C23H22Cl2N6O2 and a molecular weight of 485.38 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2R)-2-(hydroxymethyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(2R)-2-(hydroxymethyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122193798 |
| Molecular Formula | C23H22Cl2N6O2 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 2,6-dichloro-N-[(2R)-2-(hydroxymethyl)-8-methyl-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1ccc2c3c(nn2c1)CC[C@@](CO)(NC(=O)c1c(Cl)cc(-n2cnc(C)n2)cc1Cl)C3 |
| InChI | InChI=1S/C23H22Cl2N6O2/c1-13-3-4-20-16-9-23(11-32,6-5-19(16)29-30(20)10-13)27-22(33)21-17(24)7-15(8-18(21)25)31-12-26-14(2)28-31/h3-4,7-8,10,12,32H,5-6,9,11H2,1-2H3,(H,27,33)/t23-/m1/s1 |
| InChIKey | IHHHNAHSZOZUGR-HSZRJFAPSA-N |
| XLogP | 3.49 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |