C29H31F4N5O4S2 — CID 122193872
3-[4-[(1S)-1-(1,3-benzothiazol-6-ylmethylamino)-1-cyclopentylethyl]triazol-1-yl]-5-methylsulfonyl-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one (PubChem CID 122193872) has the molecular formula C29H31F4N5O4S2 and a molecular weight of 653.72 g/mol. Its IUPAC name is 3-[4-[(1S)-1-(1,3-benzothiazol-6-ylmethylamino)-1-cyclopentylethyl]triazol-1-yl]-5-methylsulfonyl-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one.
| Compound Name | 3-[4-[(1S)-1-(1,3-benzothiazol-6-ylmethylamino)-1-cyclopentylethyl]triazol-1-yl]-5-methylsulfonyl-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one |
|---|---|
| PubChem CID | 122193872 |
| Molecular Formula | C29H31F4N5O4S2 |
| Molecular Weight | 653.72 g/mol |
| Exact Mass | 653.18 |
| IUPAC Name | 3-[4-[(1S)-1-(1,3-benzothiazol-6-ylmethylamino)-1-cyclopentylethyl]triazol-1-yl]-5-methylsulfonyl-1-(2,3,5,6-tetrafluorophenoxy)pentan-2-one |
| SMILES | C[C@@](NCc1ccc2ncsc2c1)(c1cn(C(CCS(C)(=O)=O)C(=O)COc2c(F)c(F)cc(F)c2F)nn1)C1CCCC1 |
| InChI | InChI=1S/C29H31F4N5O4S2/c1-29(18-5-3-4-6-18,35-13-17-7-8-21-24(11-17)43-16-34-21)25-14-38(37-36-25)22(9-10-44(2,40)41)23(39)15-42-28-26(32)19(30)12-20(31)27(28)33/h7-8,11-12,14,16,18,22,35H,3-6,9-10,13,15H2,1-2H3/t22?,29-/m0/s1 |
| InChIKey | RSSMYFQRFUEXTN-JKDDQTOVSA-N |
| XLogP | 5.26 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.72 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|