C29H23Cl2F3N6O — CID 122193884
2,6-dichloro-4-(3-methyl-1,2,4-triazol-1-yl)-N-[(2R)-8-methyl-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]benzamide (PubChem CID 122193884) has the molecular formula C29H23Cl2F3N6O and a molecular weight of 599.44 g/mol. Its IUPAC name is 2,6-dichloro-4-(3-methyl-1,2,4-triazol-1-yl)-N-[(2R)-8-methyl-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]benzamide.
| Compound Name | 2,6-dichloro-4-(3-methyl-1,2,4-triazol-1-yl)-N-[(2R)-8-methyl-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]benzamide |
|---|---|
| PubChem CID | 122193884 |
| Molecular Formula | C29H23Cl2F3N6O |
| Molecular Weight | 599.44 g/mol |
| Exact Mass | 598.13 |
| IUPAC Name | 2,6-dichloro-4-(3-methyl-1,2,4-triazol-1-yl)-N-[(2R)-8-methyl-2-[3-(trifluoromethyl)phenyl]-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]benzamide |
| SMILES | Cc1ccc2c3c(nn2c1)CC[C@](NC(=O)c1c(Cl)cc(-n2cnc(C)n2)cc1Cl)(c1cccc(C(F)(F)F)c1)C3 |
| InChI | InChI=1S/C29H23Cl2F3N6O/c1-16-6-7-25-21-13-28(9-8-24(21)38-39(25)14-16,18-4-3-5-19(10-18)29(32,33)34)36-27(41)26-22(30)11-20(12-23(26)31)40-15-35-17(2)37-40/h3-7,10-12,14-15H,8-9,13H2,1-2H3,(H,36,41)/t28-/m1/s1 |
| InChIKey | FPQHMOYXJMVTPZ-MUUNZHRXSA-N |
| XLogP | 6.67 |
| TPSA | 77.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.44 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |