C27H27Cl2N9O — CID 122193887
2,6-dichloro-N-[(2R)-8-methyl-2-(1-propan-2-yltriazol-4-yl)-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide (PubChem CID 122193887) has the molecular formula C27H27Cl2N9O and a molecular weight of 564.48 g/mol. Its IUPAC name is 2,6-dichloro-N-[(2R)-8-methyl-2-(1-propan-2-yltriazol-4-yl)-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(2R)-8-methyl-2-(1-propan-2-yltriazol-4-yl)-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 122193887 |
| Molecular Formula | C27H27Cl2N9O |
| Molecular Weight | 564.48 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | 2,6-dichloro-N-[(2R)-8-methyl-2-(1-propan-2-yltriazol-4-yl)-3,4-dihydro-1H-pyrido[1,2-b]indazol-2-yl]-4-(3-methyl-1,2,4-triazol-1-yl)benzamide |
| SMILES | Cc1ccc2c3c(nn2c1)CC[C@](NC(=O)c1c(Cl)cc(-n2cnc(C)n2)cc1Cl)(c1cn(C(C)C)nn1)C3 |
| InChI | InChI=1S/C27H27Cl2N9O/c1-15(2)36-13-24(32-35-36)27(8-7-22-19(11-27)23-6-5-16(3)12-37(23)34-22)31-26(39)25-20(28)9-18(10-21(25)29)38-14-30-17(4)33-38/h5-6,9-10,12-15H,7-8,11H2,1-4H3,(H,31,39)/t27-/m1/s1 |
| InChIKey | YEVXARZSSLMMSC-HHHXNRCGSA-N |
| XLogP | 4.83 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |