C29H24Cl2N6O2 — CID 122193896
2,6-dichloro-N-[(7S)-10-[(E)-hydroxyiminomethyl]-2-methyl-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 122193896) has the molecular formula C29H24Cl2N6O2 and a molecular weight of 559.46 g/mol. Its IUPAC name is 2,6-dichloro-N-[(7S)-10-[(E)-hydroxyiminomethyl]-2-methyl-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(7S)-10-[(E)-hydroxyiminomethyl]-2-methyl-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 122193896 |
| Molecular Formula | C29H24Cl2N6O2 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 558.13 |
| IUPAC Name | 2,6-dichloro-N-[(7S)-10-[(E)-hydroxyiminomethyl]-2-methyl-7-phenyl-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)c(/C=N/O)c1n2C[C@@](NC(=O)c2c(Cl)cc(-n3cnnc3)cc2Cl)(c2ccccc2)CC1 |
| InChI | InChI=1S/C29H24Cl2N6O2/c1-18-7-8-25-21(11-18)22(14-34-39)26-9-10-29(15-37(25)26,19-5-3-2-4-6-19)35-28(38)27-23(30)12-20(13-24(27)31)36-16-32-33-17-36/h2-8,11-14,16-17,39H,9-10,15H2,1H3,(H,35,38)/b34-14+/t29-/m1/s1 |
| InChIKey | KADGWWNGWDVWRO-YVHDKSSSSA-N |
| XLogP | 5.92 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|