C31H31FN4O4 — CID 122193931
4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-5-yl)phenoxy]methyl]quinoline (PubChem CID 122193931) has the molecular formula C31H31FN4O4 and a molecular weight of 542.61 g/mol. Its IUPAC name is 4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-5-yl)phenoxy]methyl]quinoline.
| Compound Name | 4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-5-yl)phenoxy]methyl]quinoline |
|---|---|
| PubChem CID | 122193931 |
| Molecular Formula | C31H31FN4O4 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 4-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-[[4-(1-methyl-4-pyridin-4-ylpyrazol-5-yl)phenoxy]methyl]quinoline |
| SMILES | Cn1ncc(-c2ccncc2)c1-c1ccc(OCc2cc(OCCOCCOCCF)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C31H31FN4O4/c1-36-31(28(21-34-36)23-10-13-33-14-11-23)24-6-8-26(9-7-24)40-22-25-20-30(27-4-2-3-5-29(27)35-25)39-19-18-38-17-16-37-15-12-32/h2-11,13-14,20-21H,12,15-19,22H2,1H3 |
| InChIKey | GLFACMAFGVDYNJ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|