C28H45N2O4P — CID 122193992
N-(1-adamantyl)-3-[4-[(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]phenyl]propanamide (PubChem CID 122193992) has the molecular formula C28H45N2O4P and a molecular weight of 504.65 g/mol. Its IUPAC name is N-(1-adamantyl)-3-[4-[(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]phenyl]propanamide.
| Compound Name | N-(1-adamantyl)-3-[4-[(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]phenyl]propanamide |
|---|---|
| PubChem CID | 122193992 |
| Molecular Formula | C28H45N2O4P |
| Molecular Weight | 504.65 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | N-(1-adamantyl)-3-[4-[(1-diethoxyphosphoryl-2,2-dimethylpropyl)amino]phenyl]propanamide |
| SMILES | CCOP(=O)(OCC)C(Nc1ccc(CCC(=O)NC23CC4CC(CC(C4)C2)C3)cc1)C(C)(C)C |
| InChI | InChI=1S/C28H45N2O4P/c1-6-33-35(32,34-7-2)26(27(3,4)5)29-24-11-8-20(9-12-24)10-13-25(31)30-28-17-21-14-22(18-28)16-23(15-21)19-28/h8-9,11-12,21-23,26,29H,6-7,10,13-19H2,1-5H3,(H,30,31) |
| InChIKey | VJCPBIMLOKZOOV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.65 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|