C30H24Cl2F3N5O2 — CID 122194031
2,6-dichloro-N-[(7S)-2-methyl-7-phenyl-10-(2,2,2-trifluoro-1-hydroxyethyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide (PubChem CID 122194031) has the molecular formula C30H24Cl2F3N5O2 and a molecular weight of 614.46 g/mol. Its IUPAC name is 2,6-dichloro-N-[(7S)-2-methyl-7-phenyl-10-(2,2,2-trifluoro-1-hydroxyethyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2,6-dichloro-N-[(7S)-2-methyl-7-phenyl-10-(2,2,2-trifluoro-1-hydroxyethyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 122194031 |
| Molecular Formula | C30H24Cl2F3N5O2 |
| Molecular Weight | 614.46 g/mol |
| Exact Mass | 613.13 |
| IUPAC Name | 2,6-dichloro-N-[(7S)-2-methyl-7-phenyl-10-(2,2,2-trifluoro-1-hydroxyethyl)-8,9-dihydro-6H-pyrido[1,2-a]indol-7-yl]-4-(1,2,4-triazol-4-yl)benzamide |
| SMILES | Cc1ccc2c(c1)c(C(O)C(F)(F)F)c1n2C[C@@](NC(=O)c2c(Cl)cc(-n3cnnc3)cc2Cl)(c2ccccc2)CC1 |
| InChI | InChI=1S/C30H24Cl2F3N5O2/c1-17-7-8-23-20(11-17)25(27(41)30(33,34)35)24-9-10-29(14-40(23)24,18-5-3-2-4-6-18)38-28(42)26-21(31)12-19(13-22(26)32)39-15-36-37-16-39/h2-8,11-13,15-16,27,41H,9-10,14H2,1H3,(H,38,42)/t27?,29-/m1/s1 |
| InChIKey | SFRFFVMMZJBUPU-ZBAATNBSSA-N |
| XLogP | 6.70 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.46 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|