About 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine
2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine (PubChem CID 122194143) has the molecular formula C17H13FN8O4
and a molecular weight of 412.34 g/mol. Its IUPAC name is 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine.
Molecular Properties
| Compound Name | 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine |
| PubChem CID | 122194143 |
| Molecular Formula | C17H13FN8O4 |
| Molecular Weight | 412.34 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])nc1-c1ccccc1F |
| InChI | InChI=1S/C17H13FN8O4/c18-13-4-2-1-3-12(13)16-10(8-21-22-17(19)20)9-24(23-16)14-6-5-11(25(27)28)7-15(14)26(29)30/h1-9H,(H4,19,20,22)/b21-8+ |
| InChIKey | BVDKOSUWBSSSAL-ODCIPOBUSA-N |
| XLogP | 2.10 |
| TPSA | 180.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine?
The IUPAC name of 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine (CID 122194143) is 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine.
What is the SMILES notation for 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine?
The canonical SMILES for 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine is NC(N)=N/N=C/c1cn(-c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])nc1-c1ccccc1F.
What is the InChIKey of 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine?
The InChIKey is BVDKOSUWBSSSAL-ODCIPOBUSA-N. The full InChI is InChI=1S/C17H13FN8O4/c18-13-4-2-1-3-12(13)16-10(8-21-22-17(19)20)9-24(23-16)14-6-5-11(25(27)28)7-15(14)26(29)30/h1-9H,(H4,19,20,22)/b21-8+.
What are the key properties of 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine?
2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine has a molecular weight of 412.34 g/mol, XLogP of 2.10, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-[1-(2,4-dinitrophenyl)-3-(2-fluorophenyl)pyrazol-4-yl]methylideneamino]guanidine is sourced from PubChem (CID 122194143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).