C27H31N4O8PS — CID 122194178
ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-2-methyl-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 122194178) has the molecular formula C27H31N4O8PS and a molecular weight of 602.61 g/mol. Its IUPAC name is ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-2-methyl-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-2-methyl-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 122194178 |
| Molecular Formula | C27H31N4O8PS |
| Molecular Weight | 602.61 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | ethyl (2S)-2-[[[(2R,3S,4R,5R)-3,4-dihydroxy-2-methyl-5-(4-thiophen-2-ylpyrrolo[2,3-d]pyrimidin-7-yl)oxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(OC[C@@]1(C)O[C@@H](n2ccc3c(-c4cccs4)ncnc32)[C@H](O)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C27H31N4O8PS/c1-4-36-26(34)17(2)30-40(35,39-18-9-6-5-7-10-18)37-15-27(3)23(33)22(32)25(38-27)31-13-12-19-21(20-11-8-14-41-20)28-16-29-24(19)31/h5-14,16-17,22-23,25,32-33H,4,15H2,1-3H3,(H,30,35)/t17-,22+,23-,25+,27+,40?/m0/s1 |
| InChIKey | VDIYADKAIHTLBI-AYOAOJINSA-N |
| XLogP | 3.91 |
| TPSA | 154.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.61 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|