About 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea
1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 122194202) has the molecular formula C12H10Cl3N5O
and a molecular weight of 346.61 g/mol. Its IUPAC name is 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea |
| PubChem CID | 122194202 |
| Molecular Formula | C12H10Cl3N5O |
| Molecular Weight | 346.61 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | Nc1ncc(Cl)nc1CNC(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C12H10Cl3N5O/c13-6-2-1-3-7(10(6)15)20-12(21)18-4-8-11(16)17-5-9(14)19-8/h1-3,5H,4H2,(H2,16,17)(H2,18,20,21) |
| InChIKey | QXMBFSRFIHYKCW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea?
The IUPAC name of 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea (CID 122194202) is 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea.
What is the SMILES notation for 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea?
The canonical SMILES for 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea is Nc1ncc(Cl)nc1CNC(=O)Nc1cccc(Cl)c1Cl.
What is the InChIKey of 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea?
The InChIKey is QXMBFSRFIHYKCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl3N5O/c13-6-2-1-3-7(10(6)15)20-12(21)18-4-8-11(16)17-5-9(14)19-8/h1-3,5H,4H2,(H2,16,17)(H2,18,20,21).
What are the key properties of 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea?
1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea has a molecular weight of 346.61 g/mol, XLogP of 3.34, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-amino-6-chloropyrazin-2-yl)methyl]-3-(2,3-dichlorophenyl)urea is sourced from PubChem (CID 122194202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).