C18H15Cl2N3OS — CID 122194399
(2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3-methyl-5-phenyl-1,3-thiazolidin-4-one (PubChem CID 122194399) has the molecular formula C18H15Cl2N3OS and a molecular weight of 392.31 g/mol. Its IUPAC name is (2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3-methyl-5-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3-methyl-5-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122194399 |
| Molecular Formula | C18H15Cl2N3OS |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | (2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3-methyl-5-phenyl-1,3-thiazolidin-4-one |
| SMILES | C/C(=N\N=C1\SC(c2ccccc2)C(=O)N1C)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl2N3OS/c1-11(13-8-9-14(19)15(20)10-13)21-22-18-23(2)17(24)16(25-18)12-6-4-3-5-7-12/h3-10,16H,1-2H3/b21-11+,22-18+ |
| InChIKey | YDTPSQSJIXBDIL-RHQMAGSPSA-N |
| XLogP | 5.02 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|