C23H17Cl2N3OS — CID 122194404
(2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3,5-diphenyl-1,3-thiazolidin-4-one (PubChem CID 122194404) has the molecular formula C23H17Cl2N3OS and a molecular weight of 454.38 g/mol. Its IUPAC name is (2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3,5-diphenyl-1,3-thiazolidin-4-one.
| Compound Name | (2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3,5-diphenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 122194404 |
| Molecular Formula | C23H17Cl2N3OS |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 453.05 |
| IUPAC Name | (2E)-2-[(E)-1-(3,4-dichlorophenyl)ethylidenehydrazinylidene]-3,5-diphenyl-1,3-thiazolidin-4-one |
| SMILES | C/C(=N\N=C1\SC(c2ccccc2)C(=O)N1c1ccccc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2N3OS/c1-15(17-12-13-19(24)20(25)14-17)26-27-23-28(18-10-6-3-7-11-18)22(29)21(30-23)16-8-4-2-5-9-16/h2-14,21H,1H3/b26-15+,27-23+ |
| InChIKey | UTVUMCRVYPSVCJ-VJFFFQIWSA-N |
| XLogP | 6.59 |
| TPSA | 45.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|